
CAS 1226879-01-1
:2-Chloro-3-iodo-4-pyridinol
Description:
2-Chloro-3-iodo-4-pyridinol is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with chlorine and iodine atoms, as well as a hydroxyl group. The molecular structure features a chlorine atom at the 2-position and an iodine atom at the 3-position of the pyridine ring, with a hydroxyl group (-OH) at the 4-position. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxyl group. It is of interest in various fields, including medicinal chemistry, due to its potential biological activity. The presence of halogen substituents can influence its reactivity and interactions with biological targets. Additionally, the compound may exhibit properties such as antimicrobial or antifungal activity, making it a candidate for further research in drug development. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C5H3ClINO
InChI:InChI=1S/C5H3ClINO/c6-5-4(7)3(9)1-2-8-5/h1-2H,(H,8,9)
InChI key:InChIKey=MNLHNFORUSFEDR-UHFFFAOYSA-N
SMILES:IC=1C(O)=CC=NC1Cl
Synonyms:- 2-Chloro-3-iodo-4-pyridinol
- 4-Pyridinol, 2-chloro-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.