CymitQuimica logo

CAS 1226879-79-3

:

7-Bromo-6-methoxy-1-isoindolinone

Description:
7-Bromo-6-methoxy-1-isoindolinone is a chemical compound characterized by its isoindolinone structure, which features a bicyclic framework consisting of a benzene ring fused to a five-membered lactam. The presence of a bromine atom at the 7-position and a methoxy group at the 6-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the bromine substituent may enhance the compound's ability to interact with biological targets, making it of interest in drug discovery. As with many organic compounds, safety and handling precautions should be observed, as the reactivity of halogenated compounds can pose risks in laboratory settings.
Formula:C9H8BrNO2
InChI:InChI=1S/C9H8BrNO2/c1-13-6-3-2-5-4-11-9(12)7(5)8(6)10/h2-3H,4H2,1H3,(H,11,12)
InChI key:CLUBNXMGJUOTNO-UHFFFAOYSA-N
SMILES:COc1ccc2CN=C(c2c1Br)O
Synonyms:
  • 1H-Isoindol-1-one, 7-bromo-2,3-dihydro-6-methoxy-
Found 3 products.