CymitQuimica logo

CAS 1227-47-0

:

Piperidine, 1,1′-(dithiodipropylene)di-, dihydrochloride

Description:
Piperidine, 1,1′-(dithiodipropylene)di-, dihydrochloride is a chemical compound characterized by its piperidine backbone, which is a six-membered ring containing one nitrogen atom. This compound features a dithiodipropylene moiety, indicating the presence of two sulfur atoms linked by a propylene chain, contributing to its unique properties. As a dihydrochloride salt, it exists in a hydrated form, enhancing its solubility in polar solvents, particularly water. The presence of the piperidine ring suggests potential applications in medicinal chemistry, as piperidine derivatives are often explored for their biological activity. The compound may exhibit properties such as basicity due to the nitrogen atom in the ring, and its structure may influence its reactivity and interaction with biological systems. Additionally, the presence of sulfur atoms can impart specific characteristics, such as the ability to form disulfide bonds, which are significant in biochemical processes. Overall, this compound's unique structural features make it of interest in various chemical and pharmaceutical applications.
Formula:C16H32N2S2·2ClH
InChI:InChI=1S/C16H32N2S2.2ClH/c1-15(13-17-9-5-3-6-10-17)19-20-16(2)14-18-11-7-4-8-12-18;;/h15-16H,3-14H2,1-2H3;2*1H
InChI key:InChIKey=MNFSKRNEBGRPHY-UHFFFAOYSA-N
SMILES:C(C(SSC(CN1CCCCC1)C)C)N2CCCCC2.Cl
Synonyms:
  • NSC 3264
  • Piperidine, 1,1′-(dithiodipropylene)di-, dihydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.