CymitQuimica logo

CAS 1227048-95-4

:

Methyl 2,5-diamino-3-pyridinecarboxylate

Description:
Methyl 2,5-diamino-3-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features two amino groups (-NH2) at the 2 and 5 positions of the pyridine ring, contributing to its basicity and potential reactivity in various chemical reactions. The presence of a carboxylate group (-COOCH3) at the 3 position, in the form of a methyl ester, enhances its solubility in organic solvents and may influence its biological activity. Methyl 2,5-diamino-3-pyridinecarboxylate can participate in various chemical transformations, making it of interest in medicinal chemistry and synthetic organic chemistry. Its structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be influenced by the functional groups present and the overall molecular structure.
Formula:C7H9N3O2
InChI:InChI=1S/C7H9N3O2/c1-12-7(11)5-2-4(8)3-10-6(5)9/h2-3H,8H2,1H3,(H2,9,10)
InChI key:InChIKey=PTBHADOYGZEBKU-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(N)N=CC(N)=C1
Synonyms:
  • 3-Pyridinecarboxylic acid, 2,5-diamino-, methyl ester
  • Methyl 2,5-diamino-3-pyridinecarboxylate
  • 2,5-Diamino-3-pyridinecarboxylic acid methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.