CAS 1227070-33-8

2-(Diethylamino)-4-(trifluoromethyl)-5-thiazolecarboxylic acid

Description:

2-(Diethylamino)-4-(trifluoromethyl)-5-thiazolecarboxylic acid is a chemical compound characterized by its unique thiazole ring structure, which incorporates both a carboxylic acid functional group and a trifluoromethyl group. The presence of the diethylamino group contributes to its basicity and potential solubility in polar solvents. This compound is notable for its trifluoromethyl group, which can enhance lipophilicity and influence biological activity, making it of interest in pharmaceutical research. The thiazole moiety is often associated with various biological activities, including antimicrobial and anti-inflammatory properties. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific properties, such as melting point, solubility, and reactivity, would depend on the conditions under which it is studied. As with many thiazole derivatives, it may also exhibit interesting interactions with biological targets, warranting further investigation into its pharmacological potential.

Formula: C₉H₁₁F₃N₂O₂S

InChI: InChI=1S/C9H11F3N2O2S/c1-3-14(4-2)8-13-6(9(10,11)12)5(17-8)7(15)16/h3-4H2,1-2H3,(H,15,16)

InChI key: InChIKey=UXFYUJOXVVSMGY-UHFFFAOYSA-N

SMILES: N(CC)(CC)C1=NC(C(F)(F)F)=C(C(O)=O)S1

Synonyms:

• 2-(Diethylamino)-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid
• 5-Thiazolecarboxylic acid, 2-(diethylamino)-4-(trifluoromethyl)-
• 2-(Diethylamino)-4-(trifluoromethyl)-5-thiazolecarboxylic acid