CAS 1227187-60-1

Ethyl cis-4-(1-methylethoxy)cyclohexanecarboxylate

Description:

Ethyl cis-4-(1-methylethoxy)cyclohexanecarboxylate is an organic compound characterized by its ester functional group, which is derived from cyclohexanecarboxylic acid and ethanol. This compound features a cyclohexane ring with a cis configuration, indicating that the substituents are on the same side of the ring. The presence of the 1-methylethoxy group introduces branching and steric effects, influencing its physical and chemical properties. Typically, esters like this compound exhibit moderate polarity, which affects their solubility in various solvents. They often have pleasant, fruity odors and can be used in flavoring and fragrance applications. The compound's structure suggests potential reactivity in organic synthesis, particularly in reactions involving nucleophiles or electrophiles. Additionally, its unique configuration may impart specific biological activities, making it of interest in medicinal chemistry. Overall, ethyl cis-4-(1-methylethoxy)cyclohexanecarboxylate is a complex molecule with diverse applications in chemical synthesis and industry.

Formula: C₁₂H₂₂O₃

InChI: InChI=1/C12H22O3/c1-4-14-12(13)10-5-7-11(8-6-10)15-9(2)3/h9-11H,4-8H2,1-3H3/t10-,11+

InChI key: InChIKey=BACRLJUMCQABNV-PHIMTYICNA-N

SMILES: C(OCC)(=O)[C@@H]1CC[C@H](OC(C)C)CC1

Synonyms:

• Cyclohexanecarboxylic acid, 4-(1-methylethoxy)-, ethyl ester, cis-
• Ethyl cis-4-(1-methylethoxy)cyclohexanecarboxylate