CAS 1227210-31-2

1-(2-Bromoethyl)-5-(bromomethyl)-3-nitro-1H-pyrazole

Description:

1-(2-Bromoethyl)-5-(bromomethyl)-3-nitro-1H-pyrazole is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of bromine substituents at the 1 and 5 positions, along with a nitro group at the 3 position, contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The bromoethyl and bromomethyl groups enhance its electrophilic character, making it suitable for further chemical modifications. This compound is likely to exhibit polar characteristics due to the nitro group, which can influence its solubility and interaction with biological systems. Additionally, the presence of multiple halogen atoms may impart unique properties such as increased stability or specific reactivity patterns. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns. Overall, its structural features suggest it may be of interest in the development of pharmaceuticals or agrochemicals.

Formula: C₆H₇Br₂N₃O₂

InChI: InChI=1S/C6H7Br2N3O2/c7-1-2-10-5(4-8)3-6(9-10)11(12)13/h3H,1-2,4H2

InChI key: InChIKey=KOEOHTKJNSKFKF-UHFFFAOYSA-N

SMILES: C(CBr)N1C(CBr)=CC(N(=O)=O)=N1

Synonyms:

• 1-(2-Bromoethyl)-5-(bromomethyl)-3-nitro-1H-pyrazole
• 1H-Pyrazole, 1-(2-bromoethyl)-5-(bromomethyl)-3-nitro-

1H-Pyrazole, 1-(2-bromoethyl)-5-(bromomethyl)-3-nitro-

CAS: 1227210-31-2

Formula: C₆H₇Br₂N₃O₂

Molecular weight: 312.9467

Ref: IN-DA000J18