CAS 1227267-14-2
:6-Methoxy-5-methyl-1H-indazole
Description:
6-Methoxy-5-methyl-1H-indazole is a chemical compound characterized by its indazole core, which consists of a five-membered ring fused to a six-membered aromatic ring. The presence of a methoxy group (-OCH3) at the 6-position and a methyl group (-CH3) at the 5-position contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and pharmacology. The methoxy group can influence the compound's electronic properties and reactivity, while the indazole framework is known for its presence in various bioactive molecules. Additionally, the compound may undergo typical organic reactions such as methylation or substitution, which can be exploited in synthetic applications. As with many indazole derivatives, it may also exhibit fluorescence or other photophysical properties, making it useful in research and development contexts.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c1-6-3-7-5-10-11-8(7)4-9(6)12-2/h3-5H,1-2H3,(H,10,11)
InChI key:InChIKey=UNCJPCZJUKDBHO-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C(=CC1C)C=NN2
Synonyms:- 6-Methoxy-5-methyl-1H-indazole
- 1H-Indazole, 6-methoxy-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
