CAS 1227267-27-7
:2,6-Dimethyl-1H-indole-3-carboxylic acid
Description:
2,6-Dimethyl-1H-indole-3-carboxylic acid is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features two methyl groups at the 2 and 6 positions of the indole ring and a carboxylic acid functional group at the 3 position, contributing to its acidic properties. The presence of the carboxylic acid group allows for potential hydrogen bonding and increases its solubility in polar solvents. This compound is of interest in various fields, including medicinal chemistry and organic synthesis, due to its potential biological activities and applications. Its molecular structure can influence its reactivity and interactions with biological systems, making it a subject of study for drug development and other chemical applications. Additionally, the compound's stability, melting point, and solubility can vary based on environmental conditions and the presence of other chemical entities. Overall, 2,6-Dimethyl-1H-indole-3-carboxylic acid exemplifies the complexity and versatility of indole derivatives in chemical research.
Formula:C11H11NO2
InChI:InChI=1S/C11H11NO2/c1-6-3-4-8-9(5-6)12-7(2)10(8)11(13)14/h3-5,12H,1-2H3,(H,13,14)
InChI key:InChIKey=RINOZWROKFEBLM-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(NC1C)=CC(C)=CC2
Synonyms:- 1H-Indole-3-carboxylic acid, 2,6-dimethyl-
- 2,6-Dimethyl-1H-indole-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
