CAS 1227268-53-2
:Methyl 6-hydroxy-1H-indole-4-carboxylate
Description:
Methyl 6-hydroxy-1H-indole-4-carboxylate, identified by its CAS number 1227268-53-2, is a chemical compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features a hydroxyl group (-OH) at the 6-position and a carboxylate ester group (-COOCH3) at the 4-position, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit solubility in organic solvents, depending on its specific structure and functional groups. The presence of the hydroxyl group suggests potential for hydrogen bonding, which can influence its solubility and interaction with other molecules. Methyl 6-hydroxy-1H-indole-4-carboxylate may be of interest in medicinal chemistry due to its structural similarity to various bioactive compounds, potentially leading to applications in pharmaceuticals or as a precursor in organic synthesis. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require empirical measurement or detailed literature references for precise values.
Formula:C10H9NO3
InChI:InChI=1S/C10H9NO3/c1-14-10(13)8-4-6(12)5-9-7(8)2-3-11-9/h2-5,11-12H,1H3
InChI key:InChIKey=NYZNXHDLYVXMDE-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(=CC(O)=C1)NC=C2
Synonyms:- Methyl 6-hydroxy-1H-indole-4-carboxylate
- 1H-Indole-4-carboxylic acid, 6-hydroxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
