CAS 1227268-72-5
:1H-Pyrrolo[3,2-b]pyridine, 2-iodo-
Description:
1H-Pyrrolo[3,2-b]pyridine, 2-iodo- is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of the iodine atom at the 2-position of the pyrrolo ring enhances its reactivity, making it a valuable intermediate in organic synthesis and medicinal chemistry. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents. Its molecular structure allows for potential applications in the development of pharmaceuticals, agrochemicals, and materials science. The compound's reactivity can be attributed to the electron-withdrawing nature of the iodine substituent, which can facilitate nucleophilic substitutions and other chemical transformations. Additionally, the presence of nitrogen atoms in the ring system can influence its basicity and coordination chemistry, making it a subject of interest in coordination complexes and catalysis. Overall, 1H-Pyrrolo[3,2-b]pyridine, 2-iodo- is a versatile compound with significant implications in various fields of chemical research.
Formula:C7H5IN2
InChI:InChI=1S/C7H5IN2/c8-7-4-6-5(10-7)2-1-3-9-6/h1-4,10H
InChI key:InChIKey=JUJAFTULYLZIPX-UHFFFAOYSA-N
SMILES:IC1=CC=2C(N1)=CC=CN2
Synonyms:- 1H-Pyrrolo[3,2-b]pyridine, 2-iodo-
- 2-Iodo-1H-pyrrolo[3,2-b]pyridine
- 2-Iodo-4-azaindole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
