CAS 1227268-73-6
:5-Chloro-2-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
Description:
5-Chloro-2-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrolopyridine core substituted with chlorine and iodine atoms, as well as a phenylsulfonyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of halogen substituents, which can participate in nucleophilic substitution reactions. The sulfonyl group enhances its electrophilic character, making it a candidate for various chemical transformations. Its unique structure may confer biological activity, making it of interest in medicinal chemistry and drug development. The presence of multiple functional groups suggests that it could interact with biological targets, potentially leading to therapeutic applications. As with many halogenated compounds, it is essential to handle this substance with care, considering its potential environmental and health impacts. Overall, 5-Chloro-2-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine represents a valuable compound for research in organic synthesis and pharmacology.
Formula:C13H8ClIN2O2S
InChI:InChI=1S/C13H8ClIN2O2S/c14-10-6-9-7-12(15)17(13(9)16-8-10)20(18,19)11-4-2-1-3-5-11/h1-8H
InChI key:InChIKey=YYYUCRQCSHPIJG-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C=C1I)=CC(Cl)=CN2)C3=CC=CC=C3
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 5-chloro-2-iodo-1-(phenylsulfonyl)-
- 5-Chloro-2-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Chloro-2-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
CAS:Formula:C13H8ClIN2O2SMolecular weight:418.6373
