CAS 1227268-74-7

5-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine

Description:

5-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrolopyridine core substituted with a bromine atom and a phenylsulfonyl group. This compound typically exhibits a molecular formula that reflects its diverse functional groups, contributing to its potential reactivity and biological activity. The presence of the bromine atom can enhance its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The phenylsulfonyl moiety may impart solubility and stability, as well as influence the compound's interaction with biological targets. Such compounds are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. Additionally, the unique structural features of 5-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine may allow for specific interactions with enzymes or receptors, making it a candidate for further research in drug development. Overall, its characteristics suggest a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₃H₉BrN₂O₂S

InChI: InChI=1S/C13H9BrN2O2S/c14-13-7-6-12-11(15-13)8-9-16(12)19(17,18)10-4-2-1-3-5-10/h1-9H

InChI key: InChIKey=VHANYUYQEKQVAF-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C=2C(C=C1)=NC(Br)=CC2)C3=CC=CC=C3

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine, 5-bromo-1-(phenylsulfonyl)-
• 5-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine
• 1-(Phenylsulfonyl)-5-bromo-4-azaindole