CAS 1227268-84-9
:2-Bromo-5-fluoro-3-iodo-4-pyridinamine
Description:
2-Bromo-5-fluoro-3-iodo-4-pyridinamine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with bromine, fluorine, and iodine atoms, as well as an amino group. The molecular structure features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and potential reactivity. The presence of halogen substituents (bromo, fluoro, and iodo) can significantly influence the compound's chemical properties, such as its reactivity, polarity, and solubility in various solvents. This compound may exhibit interesting biological activities due to its unique substitution pattern, making it a candidate for pharmaceutical research. Additionally, the presence of multiple halogens can enhance its potential as a building block in organic synthesis or as a precursor for further chemical modifications. Safety and handling precautions should be observed, as halogenated compounds can pose health risks and environmental concerns. Overall, 2-Bromo-5-fluoro-3-iodo-4-pyridinamine represents a complex and potentially valuable compound in the field of medicinal chemistry and materials science.
Formula:C5H3BrFIN2
InChI:InChI=1S/C5H3BrFIN2/c6-5-3(8)4(9)2(7)1-10-5/h1H,(H2,9,10)
InChI key:InChIKey=WQEHAFATLVBNQK-UHFFFAOYSA-N
SMILES:IC=1C(N)=C(F)C=NC1Br
Synonyms:- 4-Pyridinamine, 2-bromo-5-fluoro-3-iodo-
- 2-Bromo-5-fluoro-3-iodo-4-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.