CAS 1227268-85-0: Methyl 5-iodo-1H-indazole-6-carboxylate

Description:Methyl 5-iodo-1H-indazole-6-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of the iodine atom at the 5-position of the indazole ring contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. The carboxylate group at the 6-position, esterified with a methyl group, enhances its solubility in organic solvents and may influence its biological activity. This compound is of interest in medicinal chemistry and material science due to its potential as a building block for the synthesis of more complex molecules. Its unique structural features may also impart specific pharmacological properties, making it a candidate for further research in drug development. As with many halogenated compounds, safety and handling precautions are essential due to the potential toxicity associated with iodine-containing substances.

Formula:C₉H₇IN₂O₂

InChI:InChI=1S/C9H7IN2O2/c1-14-9(13)6-3-8-5(2-7(6)10)4-11-12-8/h2-4H,1H3,(H,11,12)

InChI key:InChIKey=DGCPPOUSEIOSMG-UHFFFAOYSA-N

SMILES:O=C(OC)C1=CC=2NN=CC2C=C1I

Synonyms:
Methyl 5-iodo-1H-indazole-6-carboxylate
1H-Indazole-6-carboxylic acid, 5-iodo-, methyl ester

Found 5 products.

Product data	Purity	Price range	Estimated delivery
1H-Indazole-6-carboxylic acid, 5-iodo-, methyl ester REF: IN-DA000J4NCAS: 1227268-85-0	98%	67.00 €~269.00 €	Tue 04 Mar 25
Methyl 5-iodo-2H-indazole-6-carboxylate REF: 10-F605368CAS: 1227268-85-0	97%	38.00 €~305.00 €	Wed 05 Mar 25
1H-Indazole-6-carboxylic acid, 5-iodo-, methyl ester REF: 10-F861578CAS: 1227268-85-0	98%	57.00 €~381.00 €	Wed 05 Mar 25
Methyl 5-iodo-1H-indazole-6-carboxylate REF: 54-OR510190CAS: 1227268-85-0	>98%	519.00 €	Tue 11 Mar 25
Methyl 5-iodo-1H-indazole-6-carboxylate REF: 3D-CZB26885CAS: 1227268-85-0	Min. 95%	- - -	Discontinued product