CAS 1227268-95-2
:N-(4-Fluoro-2,3-dihydro-3-oxo-1H-indazol-6-yl)-2,2-dimethylpropanamide
Description:
N-(4-Fluoro-2,3-dihydro-3-oxo-1H-indazol-6-yl)-2,2-dimethylpropanamide is a synthetic organic compound characterized by its unique structural features, which include an indazole moiety and a dimethylpropanamide group. The presence of a fluorine atom at the para position of the indazole ring enhances its biological activity and lipophilicity. This compound is likely to exhibit properties typical of amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the amide functional group. The indazole framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as indazoles are known for their diverse biological activities. The compound's molecular structure may also influence its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion (ADME). Overall, N-(4-Fluoro-2,3-dihydro-3-oxo-1H-indazol-6-yl)-2,2-dimethylpropanamide represents a class of compounds that could be of interest in drug discovery and development, pending further investigation into its specific biological effects and mechanisms of action.
Formula:C12H14FN3O2
InChI:InChI=1S/C12H14FN3O2/c1-12(2,3)11(18)14-6-4-7(13)9-8(5-6)15-16-10(9)17/h4-5H,1-3H3,(H,14,18)(H2,15,16,17)
InChI key:InChIKey=HQISLLLLQCHAJC-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC(NC(C(C)(C)C)=O)=C1)NNC2=O
Synonyms:- N-(4-Fluoro-2,3-dihydro-3-oxo-1H-indazol-6-yl)-2,2-dimethylpropanamide
- Propanamide, N-(4-fluoro-2,3-dihydro-3-oxo-1H-indazol-6-yl)-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.