CAS 1227269-05-7
:Methyl 5-iodo-1H-indole-6-carboxylate
Description:
Methyl 5-iodo-1H-indole-6-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of the iodine atom at the 5-position of the indole ring introduces notable reactivity, making it a useful intermediate in various organic synthesis applications. The carboxylate group at the 6-position, along with the methyl ester functionality, enhances its solubility in organic solvents and contributes to its potential as a building block in medicinal chemistry. This compound may exhibit biological activity due to the indole moiety, which is often found in many natural products and pharmaceuticals. Its molecular structure allows for various substitution reactions, making it versatile for further chemical modifications. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental considerations. Overall, Methyl 5-iodo-1H-indole-6-carboxylate is a significant compound in the field of organic chemistry and drug development.
Formula:C10H8INO2
InChI:InChI=1S/C10H8INO2/c1-14-10(13)7-5-9-6(2-3-12-9)4-8(7)11/h2-5,12H,1H3
InChI key:InChIKey=MYUZUVHDDZQVTJ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C2C(=CC1I)C=CN2
Synonyms:- 1H-Indole-6-carboxylic acid, 5-iodo-, methyl ester
- Methyl 5-iodo-1H-indole-6-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
