CAS 1227269-12-6
:2-Methyl-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine
Description:
2-Methyl-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine is a chemical compound characterized by its unique pyrrolopyridine structure, which incorporates a methyl group and a phenylsulfonyl moiety. This compound typically exhibits a molecular formula that reflects its complex structure, contributing to its potential biological activity. The presence of the sulfonyl group suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Its pyrrolopyridine framework may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound is likely to be a solid at room temperature, with solubility characteristics that depend on the solvent used, often showing better solubility in polar organic solvents. Additionally, it may exhibit moderate to high stability under standard laboratory conditions, although specific stability data would depend on environmental factors such as temperature and light exposure. Overall, 2-Methyl-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine represents a class of compounds that could be valuable in drug discovery and development.
Formula:C14H12N2O2S
InChI:InChI=1S/C14H12N2O2S/c1-11-10-13-14(8-5-9-15-13)16(11)19(17,18)12-6-3-2-4-7-12/h2-10H,1H3
InChI key:InChIKey=YCNNICFKKIDMRH-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C=C1C)=NC=CC2)C3=CC=CC=C3
Synonyms:- 1H-Pyrrolo[3,2-b]pyridine, 2-methyl-1-(phenylsulfonyl)-
- 2-Methyl-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine
- 1-(benzenesulfonyl)-2-methyl-1H-pyrrolo[3,2-b]pyridine
- 1-(Phenylsulfonyl)-2-Methyl-4-azaindole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Methyl-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine
CAS:Formula:C14H12N2O2SMolecular weight:272.3223
