CAS 1227269-21-7
:2-Iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-5-carbonitrile
Description:
2-Iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-5-carbonitrile is a chemical compound characterized by its complex structure, which includes a pyrrolopyridine core, an iodo substituent, and a phenylsulfonyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and reactivity due to the presence of the iodo and nitrile functional groups. The phenylsulfonyl moiety can enhance solubility and stability, making it a useful scaffold in medicinal chemistry. The presence of the carbonitrile group may contribute to its ability to participate in nucleophilic reactions. Additionally, the compound's structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Its unique combination of functional groups may also influence its physical properties, such as melting point, solubility, and spectral characteristics. Overall, 2-Iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-5-carbonitrile represents a versatile compound of interest in both synthetic and medicinal chemistry.
Formula:C14H8IN3O2S
InChI:InChI=1S/C14H8IN3O2S/c15-13-7-11-6-10(8-16)9-17-14(11)18(13)21(19,20)12-4-2-1-3-5-12/h1-7,9H
InChI key:InChIKey=YDEWPFXDUZBRKV-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C=C1I)=CC(C#N)=CN2)C3=CC=CC=C3
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine-5-carbonitrile, 2-iodo-1-(phenylsulfonyl)-
- 2-Iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-5-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.