CAS 1227269-25-1

3,5-Dichloro-6-nitro-1H-indazole

Description:

3,5-Dichloro-6-nitro-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of two chlorine atoms at the 3 and 5 positions, along with a nitro group at the 6 position, contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and crystalline form. It is often used in research and development, particularly in the fields of medicinal chemistry and agrochemicals, due to its potential biological activity. The presence of halogen and nitro groups can influence its solubility, stability, and interaction with biological targets. Safety data sheets should be consulted for handling and storage guidelines, as compounds with halogen and nitro substituents can pose health and environmental risks. Overall, 3,5-Dichloro-6-nitro-1H-indazole is a significant compound in synthetic organic chemistry with potential applications in various scientific fields.

Formula: C₇H₃Cl₂N₃O₂

InChI: InChI=1S/C7H3Cl2N3O2/c8-4-1-3-5(10-11-7(3)9)2-6(4)12(13)14/h1-2H,(H,10,11)

InChI key: InChIKey=HFQLCQUHDTXBPO-UHFFFAOYSA-N

SMILES: ClC=1C=2C(=CC(N(=O)=O)=C(Cl)C2)NN1

Synonyms:

• 1H-Indazole, 3,5-dichloro-6-nitro-
• 3,5-Dichloro-6-nitro-1H-indazole