CAS 1227269-26-2

2-Methylpropyl 2,5-difluorobenzoate

Description:

2-Methylpropyl 2,5-difluorobenzoate is an organic compound characterized by its ester functional group, which is formed from the reaction of 2-methylpropyl alcohol and 2,5-difluorobenzoic acid. This compound features a benzene ring substituted with two fluorine atoms at the 2 and 5 positions, contributing to its unique chemical properties, such as increased electronegativity and potential for enhanced reactivity. The presence of the 2-methylpropyl group provides steric hindrance, which can influence the compound's solubility and reactivity in various chemical environments. Typically, compounds like this may exhibit moderate volatility and can be soluble in organic solvents, while being less soluble in water due to their hydrophobic characteristics. Additionally, the fluorine substituents can impart specific physical properties, such as increased thermal stability and altered dipole moments. Overall, 2-Methylpropyl 2,5-difluorobenzoate is of interest in various fields, including pharmaceuticals and materials science, due to its unique structural features and potential applications.

Formula: C₁₁H₁₂F₂O₂

InChI: InChI=1S/C11H12F2O2/c1-7(2)6-15-11(14)9-5-8(12)3-4-10(9)13/h3-5,7H,6H2,1-2H3

InChI key: InChIKey=JRRNGJIPVLPHJM-UHFFFAOYSA-N

SMILES: C(OCC(C)C)(=O)C1=C(F)C=CC(F)=C1

Synonyms:

• Benzoic acid, 2,5-difluoro-, 2-methylpropyl ester
• 2-Methylpropyl 2,5-difluorobenzoate