CAS 1227269-33-1

1,1-Dimethylethyl 4-(1,3-dithian-2-yl)-4-hydroxy-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-(1,3-dithian-2-yl)-4-hydroxy-1-piperidinecarboxylate, identified by its CAS number 1227269-33-1, is a chemical compound characterized by its complex structure, which includes a piperidine ring, a hydroxy group, and a carboxylate moiety. The presence of the 1,3-dithian-2-yl group contributes to its unique reactivity and potential applications in organic synthesis. This compound is likely to exhibit moderate polarity due to the functional groups present, influencing its solubility in various solvents. Additionally, the tert-butyl group (1,1-dimethylethyl) may enhance its steric hindrance, potentially affecting its biological activity and interactions. The hydroxy group can participate in hydrogen bonding, which may play a role in its stability and reactivity. Overall, this compound may be of interest in medicinal chemistry and synthetic organic chemistry, although specific biological activities and applications would require further investigation.

Formula: C₁₄H₂₅NO₃S₂

InChI: InChI=1S/C14H25NO3S2/c1-13(2,3)18-12(16)15-7-5-14(17,6-8-15)11-19-9-4-10-20-11/h11,17H,4-10H2,1-3H3

InChI key: InChIKey=YKJBWXLVDMRTKD-UHFFFAOYSA-N

SMILES: OC1(CCN(C(OC(C)(C)C)=O)CC1)C2SCCCS2

Synonyms:

• 1-Piperidinecarboxylic acid, 4-(1,3-dithian-2-yl)-4-hydroxy-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-(1,3-dithian-2-yl)-4-hydroxy-1-piperidinecarboxylate