
CAS 1227269-43-3
:2-[2-(4-Amino-1-piperidinyl)-2-phenylethoxy]benzonitrile
Description:
2-[2-(4-Amino-1-piperidinyl)-2-phenylethoxy]benzonitrile, with the CAS number 1227269-43-3, is a chemical compound characterized by its complex structure, which includes a benzonitrile moiety and a piperidine ring. This compound features an amino group, which contributes to its potential as a pharmacological agent. The presence of the phenylethoxy group enhances its lipophilicity, potentially influencing its bioavailability and interaction with biological targets. The piperidine ring is known for its role in various medicinal chemistry applications, often contributing to the modulation of neurotransmitter systems. As a nitrile, it may exhibit unique reactivity patterns, making it of interest in synthetic organic chemistry. The compound's specific properties, such as solubility, melting point, and reactivity, would depend on its molecular interactions and the presence of functional groups. Overall, this compound may have implications in drug development, particularly in areas related to neuropharmacology or other therapeutic fields. Further studies would be necessary to elucidate its biological activity and potential applications.
Formula:C20H23N3O
InChI:InChI=1S/C20H23N3O/c21-14-17-8-4-5-9-20(17)24-15-19(16-6-2-1-3-7-16)23-12-10-18(22)11-13-23/h1-9,18-19H,10-13,15,22H2
InChI key:InChIKey=SQRNIOYQANFIKE-UHFFFAOYSA-N
SMILES:C(COC1=C(C#N)C=CC=C1)(N2CCC(N)CC2)C3=CC=CC=C3
Synonyms:- Benzonitrile, 2-[2-(4-amino-1-piperidinyl)-2-phenylethoxy]-
- 2-[2-(4-Amino-1-piperidinyl)-2-phenylethoxy]benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(2-(4-Aminopiperidin-1-yl)-2-phenylethoxy)benzonitrile
CAS:Formula:C20H23N3OMolecular weight:321.4161
