CymitQuimica logo

CAS 1227269-46-6

:

3,7-Dibromo-5-chloro-1H-pyrrolo[3,2-b]pyridine

Description:
3,7-Dibromo-5-chloro-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes both pyridine and pyrrole rings. This compound features two bromine atoms and one chlorine atom as substituents, contributing to its reactivity and potential applications in various chemical reactions. The presence of halogens typically enhances the compound's electrophilic properties, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. The molecular structure allows for potential interactions with biological targets, which may lead to interesting pharmacological activities. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, influencing its practical applications. As with many halogenated compounds, considerations regarding toxicity and environmental impact are essential during handling and application. Overall, 3,7-Dibromo-5-chloro-1H-pyrrolo[3,2-b]pyridine represents a valuable compound in the field of medicinal chemistry and materials science.
Formula:C7H3Br2ClN2
InChI:InChI=1S/C7H3Br2ClN2/c8-3-1-5(10)12-7-4(9)2-11-6(3)7/h1-2,11H
InChI key:InChIKey=GWNDHEVVONTQLC-UHFFFAOYSA-N
SMILES:BrC1=C2C(=NC(Cl)=C1)C(Br)=CN2
Synonyms:
  • 3,7-Dibromo-5-chloro-1H-pyrrolo[3,2-b]pyridine
  • 1H-Pyrrolo[3,2-b]pyridine, 3,7-dibromo-5-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.