CymitQuimica logo

CAS 1227270-22-5

:

4-Methoxy-1-(phenylsulfonyl)-1H-pyrrolo[3,2-c]pyridine

Description:
4-Methoxy-1-(phenylsulfonyl)-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both a methoxy group and a phenylsulfonyl moiety. The presence of the methoxy group typically enhances the compound's solubility and can influence its electronic properties, while the phenylsulfonyl group may contribute to its reactivity and potential biological activity. This compound is likely to exhibit a range of chemical properties, including moderate polarity due to the sulfonyl and methoxy substituents, which can affect its interactions in various chemical environments. Additionally, the pyrrolopyridine framework may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C14H12N2O3S
InChI:InChI=1S/C14H12N2O3S/c1-19-14-12-8-10-16(13(12)7-9-15-14)20(17,18)11-5-3-2-4-6-11/h2-10H,1H3
InChI key:InChIKey=MOLNWPPFLNINEY-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(=C(OC)N=CC2)C=C1)C3=CC=CC=C3
Synonyms:
  • 4-Methoxy-1-(phenylsulfonyl)-1H-pyrrolo[3,2-c]pyridine
  • 1H-Pyrrolo[3,2-c]pyridine, 4-methoxy-1-(phenylsulfonyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.