CAS 1227270-26-9

1H-Pyrrolo[2,3-c]pyridine, 2-iodo-

Description:

1H-Pyrrolo[2,3-c]pyridine, 2-iodo- is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of the iodine atom at the 2-position of the pyrrolo ring enhances its reactivity, making it a valuable intermediate in various synthetic applications, particularly in medicinal chemistry and material science. This compound typically exhibits a pale yellow to brown appearance and is soluble in organic solvents, reflecting its non-polar characteristics. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the compound may undergo various chemical reactions, including nucleophilic substitutions and coupling reactions, due to the presence of the iodine atom. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed. Overall, 1H-Pyrrolo[2,3-c]pyridine, 2-iodo- serves as an important building block in organic synthesis and pharmaceutical research.

Formula: C₇H₅IN₂

InChI: InChI=1S/C7H5IN2/c8-7-3-5-1-2-9-4-6(5)10-7/h1-4,10H

InChI key: InChIKey=WSBRJCFHGLRDAF-UHFFFAOYSA-N

SMILES: IC1=CC=2C(N1)=CN=CC2

Synonyms:

• 1H-Pyrrolo[2,3-c]pyridine, 2-iodo-
• 2-Iodo-1H-pyrrolo[2,3-c]pyridine
• 2-Iodo-6-azaindole

2-iodo-1H-pyrrolo[2,3-c]pyridine

CAS: 1227270-26-9

Formula: C₇H₅IN₂

Molecular weight: 244.0325

Ref: IN-DA000J5J

2-Iodo-1H-pyrrolo[2,3-c]pyridine

CAS: 1227270-26-9

Versatile small molecule scaffold

Formula: C₇H₅IN₂

Purity: Min. 95%

Molecular weight: 244.03 g/mol

Ref: 3D-CZB27026