CAS 1227270-54-3
:Methyl 3-iodo-5-methoxy-1H-indazole-6-carboxylate
Description:
Methyl 3-iodo-5-methoxy-1H-indazole-6-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of the iodine atom at the 3-position and a methoxy group at the 5-position contributes to its unique reactivity and potential applications in medicinal chemistry. The carboxylate functional group at the 6-position, along with the methyl ester, enhances its solubility and reactivity, making it suitable for various synthetic pathways. This compound may exhibit biological activity, potentially serving as a scaffold for drug development, particularly in the fields of oncology or neurology. Its structural features suggest that it could participate in electrophilic substitution reactions due to the electron-withdrawing nature of the iodine atom and the electron-donating methoxy group. Overall, Methyl 3-iodo-5-methoxy-1H-indazole-6-carboxylate represents a versatile compound with significant implications in chemical research and pharmaceutical applications.
Formula:C10H9IN2O3
InChI:InChI=1S/C10H9IN2O3/c1-15-8-4-5-7(12-13-9(5)11)3-6(8)10(14)16-2/h3-4H,1-2H3,(H,12,13)
InChI key:InChIKey=MFDCLAQHQIUGHQ-UHFFFAOYSA-N
SMILES:IC=1C=2C(=CC(C(OC)=O)=C(OC)C2)NN1
Synonyms:- 1H-Indazole-6-carboxylic acid, 3-iodo-5-methoxy-, methyl ester
- Methyl 3-iodo-5-methoxy-1H-indazole-6-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
