CAS 1227270-61-2

5,6-Dimethoxy-1H-pyrrolo[2,3-b]pyridine

Description:

5,6-Dimethoxy-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of two methoxy groups at the 5 and 6 positions enhances its solubility and reactivity, making it a subject of interest in medicinal chemistry and drug development. This compound typically exhibits a range of biological activities, potentially including neuroprotective effects, due to its structural similarity to various neurotransmitters. Its molecular structure allows for interactions with biological targets, which can lead to diverse pharmacological effects. Additionally, the compound's stability and reactivity can be influenced by the electron-donating nature of the methoxy groups, affecting its behavior in chemical reactions. As with many heterocycles, it may also participate in various synthetic transformations, making it a valuable intermediate in organic synthesis. Overall, 5,6-Dimethoxy-1H-pyrrolo[2,3-b]pyridine represents a significant compound in the exploration of new therapeutic agents.

Formula: C₉H₁₀N₂O₂

InChI: InChI=1S/C9H10N2O2/c1-12-7-5-6-3-4-10-8(6)11-9(7)13-2/h3-5H,1-2H3,(H,10,11)

InChI key: InChIKey=BHISQMPGJQHROG-UHFFFAOYSA-N

SMILES: O(C)C=1C=C2C(=NC1OC)NC=C2

Synonyms:

• 5,6-Dimethoxy-1H-pyrrolo[2,3-b]pyridine
• 1H-Pyrrolo[2,3-b]pyridine, 5,6-dimethoxy-