CAS 1227270-65-6
:3-Iodo-4-(phenylmethoxy)-1H-pyrrolo[2,3-b]pyridine
Description:
3-Iodo-4-(phenylmethoxy)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrolopyridine core substituted with an iodine atom and a phenylmethoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the iodine substituent, which can participate in nucleophilic substitution reactions. The phenylmethoxy group enhances its lipophilicity, potentially influencing its solubility in organic solvents and biological systems. Additionally, the presence of the pyrrolopyridine framework may impart interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's molecular interactions and reactivity can be further explored through various analytical techniques, including NMR and mass spectrometry, to elucidate its behavior in different chemical environments. Overall, 3-Iodo-4-(phenylmethoxy)-1H-pyrrolo[2,3-b]pyridine represents a unique structure with potential applications in drug development and organic synthesis.
Formula:C14H11IN2O
InChI:InChI=1S/C14H11IN2O/c15-11-8-17-14-13(11)12(6-7-16-14)18-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,16,17)
InChI key:InChIKey=MDJCZFWKMPSCSL-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C3C(NC=C3I)=NC=C2
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 3-iodo-4-(phenylmethoxy)-
- 3-Iodo-4-(phenylmethoxy)-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
