CAS 1227270-87-2
:Methyl 3-(acetyloxy)-6-bromo-1H-indole-4-carboxylate
Description:
Methyl 3-(acetyloxy)-6-bromo-1H-indole-4-carboxylate is a synthetic organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a bromo substituent at the 6-position, which can influence its reactivity and biological activity. The presence of an acetyloxy group at the 3-position and a carboxylate ester at the 4-position contributes to its chemical properties, making it a potential candidate for various applications in medicinal chemistry. The methyl ester group enhances its lipophilicity, potentially improving its bioavailability. Additionally, the compound may exhibit interesting pharmacological properties due to the indole core, which is known for its presence in many biologically active molecules. As with many synthetic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, this compound represents a unique structure that may be of interest in drug development and chemical research.
Formula:C12H10BrNO4
InChI:InChI=1S/C12H10BrNO4/c1-6(15)18-10-5-14-9-4-7(13)3-8(11(9)10)12(16)17-2/h3-5,14H,1-2H3
InChI key:InChIKey=MGFQINSPINWINM-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(=CC(Br)=C1)NC=C2OC(C)=O
Synonyms:- Methyl 3-(acetyloxy)-6-bromo-1H-indole-4-carboxylate
- 1H-Indole-4-carboxylic acid, 3-(acetyloxy)-6-bromo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.