CymitQuimica logo

CAS 1227270-98-5

:

3-Iodo-1-(phenylmethyl)-1H-pyrrolo[2,3-b]pyridin-4-ol

Description:
3-Iodo-1-(phenylmethyl)-1H-pyrrolo[2,3-b]pyridin-4-ol is a chemical compound characterized by its complex structure, which includes a pyrrolo[2,3-b]pyridine core, an iodine substituent, and a phenylmethyl group. This compound is notable for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for developing new pharmaceuticals. The presence of the iodine atom can influence the compound's reactivity and lipophilicity, potentially enhancing its interaction with biological targets. The hydroxyl group at the 4-position contributes to its polarity and may play a role in hydrogen bonding, affecting solubility and bioavailability. Additionally, the phenylmethyl group can provide steric bulk and electronic effects that may modulate the compound's pharmacological properties. Overall, 3-Iodo-1-(phenylmethyl)-1H-pyrrolo[2,3-b]pyridin-4-ol represents a unique structure with implications for further research in drug development and chemical synthesis.
Formula:C14H11IN2O
InChI:InChI=1S/C14H11IN2O/c15-11-9-17(8-10-4-2-1-3-5-10)14-13(11)12(18)6-7-16-14/h1-7,9H,8H2,(H,16,18)
InChI key:InChIKey=ZNVPENCWWDLOFD-UHFFFAOYSA-N
SMILES:C(N1C=2C(C(I)=C1)=C(O)C=CN2)C3=CC=CC=C3
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridin-4-ol, 3-iodo-1-(phenylmethyl)-
  • 3-Iodo-1-(phenylmethyl)-1H-pyrrolo[2,3-b]pyridin-4-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.