
CAS 1227370-65-1
:4-[(Methylsulfonyl)methyl]benzenemethanol
Description:
4-[(Methylsulfonyl)methyl]benzenemethanol, identified by its CAS number 1227370-65-1, is an organic compound characterized by the presence of a benzene ring substituted with both a hydroxymethyl group and a methylsulfonyl group. This compound features a sulfonyl group (-SO2-) attached to a methyl group, which enhances its solubility in polar solvents and may influence its reactivity and biological activity. The hydroxymethyl group (-CH2OH) contributes to its potential as a functionalized alcohol, making it a candidate for various chemical reactions, including oxidation and esterification. The presence of both functional groups suggests that this compound may exhibit interesting properties, such as potential antimicrobial or anti-inflammatory activities, although specific biological data would be required for confirmation. Additionally, its structural characteristics may allow for interactions with biological targets, making it of interest in medicinal chemistry. Overall, 4-[(Methylsulfonyl)methyl]benzenemethanol represents a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C9H12O3S
InChI:InChI=1S/C9H12O3S/c1-13(11,12)7-9-4-2-8(6-10)3-5-9/h2-5,10H,6-7H2,1H3
InChI key:InChIKey=SYQAHAMSZLVYEQ-UHFFFAOYSA-N
SMILES:C(S(C)(=O)=O)C1=CC=C(CO)C=C1
Synonyms:- [4-(Methanesulfonylmethyl)phenyl]methanol
- 4-[(Methylsulfonyl)methyl]benzenemethanol
- Benzenemethanol, 4-[(methylsulfonyl)methyl]-
- (4-((Methylsulfonyl)methyl)phenyl)methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.