CymitQuimica logo

CAS 1227382-06-0

:

3-Fluoro-N-2-propyn-1-yl-5-(trifluoromethyl)-2-pyridinamine

Description:
3-Fluoro-N-2-propyn-1-yl-5-(trifluoromethyl)-2-pyridinamine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with both a trifluoromethyl group and an amino group. The presence of the fluorine atoms contributes to its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The propynyl group enhances the compound's ability to participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Its molecular structure suggests potential interactions with biological targets, which may lead to specific pharmacological effects. Additionally, the trifluoromethyl group is known to influence lipophilicity and metabolic stability, factors that are crucial in drug design. Overall, this compound exemplifies the importance of halogenated amines in the development of new therapeutic agents, with its unique functional groups providing opportunities for further exploration in chemical and biological research.
Formula:C9H6F4N2
InChI:InChI=1S/C9H6F4N2/c1-2-3-14-8-7(10)4-6(5-15-8)9(11,12)13/h1,4-5H,3H2,(H,14,15)
InChI key:InChIKey=YKHNOHZPZFEPSO-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(F)C(NCC#C)=NC1
Synonyms:
  • 3-Fluoro-N-2-propyn-1-yl-5-(trifluoromethyl)-2-pyridinamine
  • 2-Pyridinamine, 3-fluoro-N-2-propyn-1-yl-5-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.