CAS 1227406-73-6

6-Methyl-α-oxo-2-pyrazineacetic acid

Description:

6-Methyl-α-oxo-2-pyrazineacetic acid is a chemical compound characterized by its pyrazine ring structure, which contributes to its unique reactivity and properties. This compound features a methyl group and an α-oxo group, which enhance its potential for various chemical reactions, including those involving nucleophiles and electrophiles. The presence of the carboxylic acid functional group allows for hydrogen bonding and solubility in polar solvents, making it useful in organic synthesis and pharmaceutical applications. Its molecular structure suggests potential biological activity, which may be explored in drug development or as a biochemical probe. The compound's CAS number, 1227406-73-6, facilitates its identification in chemical databases and literature. Overall, 6-Methyl-α-oxo-2-pyrazineacetic acid is a versatile compound with significant implications in both synthetic chemistry and medicinal chemistry, warranting further investigation into its properties and applications.

Formula: C₇H₆N₂O₃

InChI: InChI=1S/C7H6N2O3/c1-4-2-8-3-5(9-4)6(10)7(11)12/h2-3H,1H3,(H,11,12)

InChI key: InChIKey=VFCJHYOITUCBKL-UHFFFAOYSA-N

SMILES: C(C(O)=O)(=O)C1=NC(C)=CN=C1

Synonyms:

• 2-Pyrazineacetic acid, 6-methyl-α-oxo-
• 2-(6-Methylpyrazin-2-yl)-2-oxoacetic acid
• 6-Methyl-α-oxo-2-pyrazineacetic acid