CAS 122741-44-0
:2,3,4,6-tetra-O-benzyl-D-glucopyranosyl fluoride
Description:
2,3,4,6-Tetra-O-benzyl-D-glucopyranosyl fluoride is a glycosyl fluoride derivative of D-glucose, characterized by the presence of four benzyl groups attached to the hydroxyl positions at C-2, C-3, C-4, and C-6 of the glucopyranose ring, while the anomeric hydroxyl group is replaced by a fluoride atom. This compound is typically used in organic synthesis, particularly in glycosylation reactions, due to its ability to act as a glycosyl donor. The presence of the benzyl groups enhances the lipophilicity and stability of the molecule, making it more soluble in organic solvents. Additionally, the fluorine atom can participate in various chemical transformations, providing unique reactivity compared to other glycosyl donors. The compound is generally stable under standard laboratory conditions but should be handled with care due to the potential reactivity of the fluoride group. Its applications extend to the synthesis of complex carbohydrates and glycosides, contributing to the fields of medicinal chemistry and carbohydrate chemistry.
Formula:C34H35FO5
InChI:InChI=1/C34H35FO5/c35-34-33(39-24-29-19-11-4-12-20-29)32(38-23-28-17-9-3-10-18-28)31(37-22-27-15-7-2-8-16-27)30(40-34)25-36-21-26-13-5-1-6-14-26/h1-20,30-34H,21-25H2/t30-,31-,32+,33-,34?/m1/s1
Synonyms:- 2,3,4,6-Tetra-O-benzyl-D-glucopyranosyl Fluoride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3,4,6-Tetra-o-benzyl-β-d-glucopyranosyl fluoride
CAS:Formula:C34H35FO5Purity:96.0%Molecular weight:542.63712,3,4,6-Tetra-O-benzyl-D-glucopyranosyl Fluoride
CAS:Formula:C34H35FO5Purity:>96.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:542.652,3,4,6-Tetra-O-benzyl-D-glucopyranosyl fluoride
CAS:<p>2,3,4,6-Tetra-O-benzyl-D-glucopyranosyl fluoride is a postulated molecule that has been observed in the gas phase. The molecule is a fluorinated analog of 2,3,4,6-tetra-O-acetyl-D-glucopyranosyl fluoride and was detected by its characteristic nuclear magnetic resonance (NMR) data. It was found to be more nucleophilic than 2,3,4,6-tetra-O-acetyl-D glycosyl fluoride. As with the latter molecule 2,3,4,6-tetra -O benzyl glucopyranosyl fluoride can form adducts with hydrogen fluoride or oxocarbenium ions.<br>2,3,4,6 tetra -o benzyl glucopyranosyl fluoride has not been prepared and characterized experimentally yet.</p>Formula:C34H35FO5Purity:Min. 95%Molecular weight:542.64 g/mol



