
CAS 122741-61-1
:1-Cyclohexene-1-carboxylic acid, 3-(phosphonooxy)-, (S)-
Description:
1-Cyclohexene-1-carboxylic acid, 3-(phosphonooxy)-, (S)-, with CAS number 122741-61-1, is an organic compound characterized by its cyclohexene structure, which features a double bond and a carboxylic acid functional group. The presence of the phosphonooxy group indicates that it contains a phosphorus atom bonded to an oxygen atom, contributing to its potential as a phosphonate derivative. This compound is typically used in biochemical applications, particularly in the synthesis of various pharmaceuticals and agrochemicals. Its stereochemistry, denoted by the (S) configuration, suggests that it has specific spatial arrangements that can influence its biological activity and reactivity. The compound is likely to exhibit properties typical of carboxylic acids, such as acidity and the ability to form esters or amides. Additionally, the cyclohexene ring may impart unique reactivity patterns, making it a valuable intermediate in organic synthesis. Overall, its structural features suggest potential utility in various chemical and biological contexts.
Formula:C7H11O6P
InChI:InChI=1S/C7H11O6P/c8-7(9)5-2-1-3-6(4-5)13-14(10,11)12/h4,6H,1-3H2,(H,8,9)(H2,10,11,12)/t6-/m0/s1
InChI key:InChIKey=XGUYJKAVWJYMQN-LURJTMIESA-N
SMILES:O(P(=O)(O)O)[C@@H]1C=C(C(O)=O)CCC1
Synonyms:- 1-Cyclohexene-1-carboxylic acid, 3-(phosphonooxy)-, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Cyclohexene-1-carboxylic acid, 3-(phosphonooxy)-, (S)- (9CI)
CAS:Formula:C7H11O6PMolecular weight:222.1324
