CymitQuimica logo

CAS 1227465-56-6

:

4-Propyl-4-piperidinecarboxylic acid

Description:
4-Propyl-4-piperidinecarboxylic acid is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a propyl group attached to the fourth carbon of the piperidine ring and a carboxylic acid functional group at the same position, contributing to its acidity and potential reactivity. The presence of the carboxylic acid group allows for hydrogen bonding, which can influence its solubility in polar solvents. The propyl substituent can affect the compound's lipophilicity, potentially impacting its biological activity and interaction with various receptors or enzymes. As a piperidine derivative, it may exhibit properties relevant to medicinal chemistry, including potential applications in drug development. Its molecular structure suggests that it could participate in various chemical reactions, including esterification and amidation, making it a versatile compound in synthetic organic chemistry. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications.
Formula:C9H17NO2
InChI:InChI=1S/C9H17NO2/c1-2-3-9(8(11)12)4-6-10-7-5-9/h10H,2-7H2,1H3,(H,11,12)
InChI key:InChIKey=NRBRYBMTNCETLK-UHFFFAOYSA-N
SMILES:C(CC)C1(C(O)=O)CCNCC1
Synonyms:
  • 4-Propyl-4-piperidinecarboxylic acid
  • 4-Propylpiperidine-4-carboxylic acid
  • 4-Piperidinecarboxylic acid, 4-propyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.