CAS 1227465-60-2

5-Amino-6-methyl-1H-isoindole-1,3(2H)-dione

Description:

5-Amino-6-methyl-1H-isoindole-1,3(2H)-dione, also known as a derivative of isoindole, is a heterocyclic organic compound characterized by its unique bicyclic structure that includes an isoindole core. This compound features an amino group and a methyl group, which contribute to its reactivity and potential biological activity. The presence of the dione functional groups indicates that it can participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the amino group, which can enhance solubility and bioactivity. Additionally, the compound may exhibit properties such as fluorescence or photostability, making it of interest in materials science. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 5-Amino-6-methyl-1H-isoindole-1,3(2H)-dione represents a versatile scaffold for further chemical exploration and application.

Formula: C₉H₈N₂O₂

InChI: InChI=1S/C9H8N2O2/c1-4-2-5-6(3-7(4)10)9(13)11-8(5)12/h2-3H,10H2,1H3,(H,11,12,13)

InChI key: InChIKey=LPZKZQICLYRDON-UHFFFAOYSA-N

SMILES: O=C1C=2C(C(=O)N1)=CC(N)=C(C)C2

Synonyms:

• 5-Amino-6-methyl-1H-isoindole-1,3(2H)-dione
• 1H-Isoindole-1,3(2H)-dione, 5-amino-6-methyl-