CymitQuimica logo

CAS 1227465-61-3

:

5-Amino-α-methyl-1,3,4-thiadiazole-2-methanamine

Description:
5-Amino-α-methyl-1,3,4-thiadiazole-2-methanamine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, an amino group, and a methyl substituent. This compound is part of a class of heterocyclic compounds that often exhibit biological activity, making them of interest in pharmaceutical research. The presence of the amino group suggests potential for hydrogen bonding and reactivity, which can influence its solubility and interaction with biological targets. The thiadiazole moiety is known for its diverse applications, including antimicrobial and antifungal properties. Additionally, the α-methyl group can affect the compound's steric properties and overall reactivity. As with many nitrogen-containing heterocycles, this compound may also exhibit interesting electronic properties due to the presence of multiple nitrogen atoms. Overall, 5-Amino-α-methyl-1,3,4-thiadiazole-2-methanamine is a compound of interest for further study in medicinal chemistry and related fields.
Formula:C4H8N4S
InChI:InChI=1S/C4H8N4S/c1-2(5)3-7-8-4(6)9-3/h2H,5H2,1H3,(H2,6,8)
InChI key:InChIKey=GSVLRMMVNXHIMU-UHFFFAOYSA-N
SMILES:C(C)(N)C=1SC(N)=NN1
Synonyms:
  • 1,3,4-Thiadiazole-2-methanamine, 5-amino-α-methyl-
  • 5-Amino-α-methyl-1,3,4-thiadiazole-2-methanamine
  • 5-(1-Aminoethyl)-1,3,4-thiadiazol-2-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.