CAS 1227465-62-4
:5-Bromo-3-cyclohexyl-1H-1,2,4-triazole
Description:
5-Bromo-3-cyclohexyl-1H-1,2,4-triazole is a heterocyclic compound characterized by the presence of a triazole ring, which consists of three nitrogen atoms and two carbon atoms in a five-membered ring. The bromine substituent at the 5-position and the cyclohexyl group at the 3-position contribute to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis due to the presence of the triazole moiety, which is known for its biological activity. The bromine atom can enhance reactivity and facilitate further chemical modifications. Additionally, the cyclohexyl group may influence the compound's lipophilicity and steric properties, affecting its interaction with biological targets. Overall, 5-Bromo-3-cyclohexyl-1H-1,2,4-triazole is a compound of interest in various fields of research, particularly in medicinal chemistry and material science.
Formula:C8H12BrN3
InChI:InChI=1S/C8H12BrN3/c9-8-10-7(11-12-8)6-4-2-1-3-5-6/h6H,1-5H2,(H,10,11,12)
InChI key:InChIKey=WBXIMLMFQQMREM-UHFFFAOYSA-N
SMILES:BrC=1NC(=NN1)C2CCCCC2
Synonyms:- 5-Bromo-3-cyclohexyl-1H-1,2,4-triazole
- 1H-1,2,4-Triazole, 5-bromo-3-cyclohexyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
