CymitQuimica logo

CAS 1227465-71-5

:

2-Amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one

Description:
2-Amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one is a heterocyclic organic compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and carbon atoms. The presence of three nitrogen atoms in the triazine ring contributes to its basicity and potential reactivity, making it a candidate for various chemical reactions. The compound features an amino group, which can participate in hydrogen bonding and enhance its solubility in polar solvents. Its spiro structure indicates that it has a rigid conformation, which can influence its biological activity and interactions with other molecules. The enone functional group suggests potential for electrophilic reactivity, allowing for further derivatization. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. However, specific applications and biological activities would require further investigation through experimental studies. Overall, 2-Amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one represents a complex and potentially versatile chemical entity within the realm of organic and medicinal chemistry.
Formula:C7H12N4O
InChI:InChI=1S/C7H12N4O/c8-6-10-5(12)7(11-6)1-3-9-4-2-7/h9H,1-4H2,(H3,8,10,11,12)
InChI key:InChIKey=TXVFSPSHCYEXGF-UHFFFAOYSA-N
SMILES:O=C1C2(NC(N)=N1)CCNCC2
Synonyms:
  • 1,3,8-Triazaspiro[4.5]dec-1-en-4-one, 2-amino-
  • 2-Amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.