CAS 1227465-83-9

5-Amino-1,2-dihydro-4,6-dimethyl-2-oxo-3-pyridinecarboxamide

Description:

5-Amino-1,2-dihydro-4,6-dimethyl-2-oxo-3-pyridinecarboxamide is a chemical compound characterized by its pyridine ring structure, which is substituted with various functional groups. This compound features an amino group, a carbonyl group, and multiple methyl groups, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxamide functional group. The compound's structure suggests potential biological activity, making it of interest in pharmaceutical research. Its molecular framework allows for various interactions, including hydrogen bonding, which can influence its reactivity and stability. Additionally, the presence of the dimethyl and amino groups may enhance its lipophilicity and influence its pharmacokinetic properties. Overall, 5-Amino-1,2-dihydro-4,6-dimethyl-2-oxo-3-pyridinecarboxamide is a compound with potential applications in medicinal chemistry, warranting further investigation into its biological effects and mechanisms of action.

Formula: C₈H₁₁N₃O₂

InChI: InChI=1S/C8H11N3O2/c1-3-5(7(10)12)8(13)11-4(2)6(3)9/h9H2,1-2H3,(H2,10,12)(H,11,13)

InChI key: InChIKey=NRWLIKUNUBFPJR-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=C(C)C(N)=C(C)NC1=O

Synonyms:

• 3-Pyridinecarboxamide, 5-amino-1,2-dihydro-4,6-dimethyl-2-oxo-
• 5-Amino-1,2-dihydro-4,6-dimethyl-2-oxo-3-pyridinecarboxamide

5-Amino-4,6-dimethyl-2-oxo-1,2-dihydro-3-pyridine carboxamide

CAS: 1227465-83-9

Formula: C₈H₁₁N₃O₂

Purity: 95.0%

Molecular weight: 181.195

Ref: 10-F063287