CymitQuimica logo

CAS 1227489-69-1

:

3-Bromo-2-(chloromethyl)-5-(trifluoromethyl)pyridine

Description:
3-Bromo-2-(chloromethyl)-5-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 3-position and a chloromethyl group at the 2-position introduces significant reactivity, making it useful in various chemical syntheses. The trifluoromethyl group at the 5-position enhances the compound's lipophilicity and can influence its biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and is soluble in organic solvents. Its unique functional groups suggest potential applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the presence of halogens can impart specific properties such as increased stability and altered electronic characteristics, which are valuable in designing compounds for targeted applications. Safety precautions should be taken when handling this compound due to the presence of halogens, which can be toxic and reactive under certain conditions.
Formula:C7H4BrClF3N
InChI:InChI=1S/C7H4BrClF3N/c8-5-1-4(7(10,11)12)3-13-6(5)2-9/h1,3H,2H2
InChI key:InChIKey=AGOGRASJTIWXAN-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(Br)C(CCl)=NC1
Synonyms:
  • Pyridine, 3-bromo-2-(chloromethyl)-5-(trifluoromethyl)-
  • 3-Bromo-2-(chloromethyl)-5-(trifluoromethyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.