
CAS 1227490-59-6
:3-Bromo-2-methoxy-4-pyridinemethanol
Description:
3-Bromo-2-methoxy-4-pyridinemethanol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 3-position and a methoxy group at the 2-position of the pyridine ring contributes to its unique reactivity and properties. The hydroxymethyl group (-CH2OH) at the 4-position enhances its potential for hydrogen bonding, making it soluble in polar solvents. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The presence of both electron-withdrawing (bromine) and electron-donating (methoxy) groups can influence its reactivity and stability. Overall, 3-Bromo-2-methoxy-4-pyridinemethanol is a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C7H8BrNO2
InChI:InChI=1S/C7H8BrNO2/c1-11-7-6(8)5(4-10)2-3-9-7/h2-3,10H,4H2,1H3
InChI key:InChIKey=NHGPLBBOUAXTNA-UHFFFAOYSA-N
SMILES:C(O)C=1C(Br)=C(OC)N=CC1
Synonyms:- 3-Bromo-2-methoxy-4-pyridinemethanol
- 4-Pyridinemethanol, 3-bromo-2-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.