CAS 1227496-52-7

3-(Bromomethyl)-6-methoxy-2-(trifluoromethyl)pyridine

Description:

3-(Bromomethyl)-6-methoxy-2-(trifluoromethyl)pyridine is a pyridine derivative characterized by the presence of a bromomethyl group, a methoxy group, and a trifluoromethyl group attached to the pyridine ring. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as dichloromethane and acetone, but may have limited solubility in water due to the hydrophobic nature of the trifluoromethyl and methoxy groups. The bromomethyl group can serve as a reactive site for further chemical modifications, making it useful in synthetic organic chemistry. The trifluoromethyl group imparts unique electronic properties, enhancing the compound's lipophilicity and potentially influencing its biological activity. Additionally, the methoxy group can affect the compound's reactivity and stability. Overall, this compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as an intermediate in organic synthesis.

Formula: C₈H₇BrF₃NO

InChI: InChI=1S/C8H7BrF3NO/c1-14-6-3-2-5(4-9)7(13-6)8(10,11)12/h2-3H,4H2,1H3

InChI key: InChIKey=YHEZPJLJVFMJLE-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(CBr)C=CC(OC)=N1

Synonyms:

• 3-(Bromomethyl)-6-methoxy-2-(trifluoromethyl)pyridine
• Pyridine, 3-(bromomethyl)-6-methoxy-2-(trifluoromethyl)-