CAS 1227499-12-8

2,5-Difluoro-4-pyridineacetic acid

Description:

2,5-Difluoro-4-pyridineacetic acid is a chemical compound characterized by its pyridine ring structure, which is substituted with two fluorine atoms at the 2 and 5 positions and a carboxylic acid group at the 4 position. This compound typically exhibits properties associated with both aromatic and aliphatic acids, including moderate solubility in polar solvents due to the presence of the carboxylic acid functional group. The fluorine substituents can influence the compound's reactivity, stability, and interaction with biological systems, often enhancing lipophilicity and altering hydrogen bonding capabilities. As a pyridine derivative, it may exhibit biological activity, making it of interest in pharmaceutical research. The presence of fluorine atoms can also impart unique electronic properties, potentially affecting the compound's acidity and reactivity. Overall, 2,5-Difluoro-4-pyridineacetic acid is a versatile compound with applications in various fields, including medicinal chemistry and agrochemicals, due to its distinctive structural features and functional groups.

Formula: C₇H₅F₂NO₂

InChI: InChI=1S/C7H5F2NO2/c8-5-3-10-6(9)1-4(5)2-7(11)12/h1,3H,2H2,(H,11,12)

InChI key: InChIKey=WIMRKTLKPPHJOX-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C(F)=CN=C(F)C1

Synonyms:

• 2,5-Difluoro-4-pyridineacetic acid
• 4-Pyridineacetic acid, 2,5-difluoro-