CAS 1227499-23-1

3-Chloro-2-methyl-4-pyridinol

Description:

3-Chloro-2-methyl-4-pyridinol is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chlorine atom and a methyl group attached to the pyridine ring, specifically at the 3 and 2 positions, respectively, while a hydroxyl group is present at the 4 position. The presence of these functional groups contributes to its chemical reactivity and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group. The chlorine substituent can influence its biological activity, making it of interest in pharmaceutical research. Additionally, the compound may have applications in agrochemicals or as an intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 3-Chloro-2-methyl-4-pyridinol is a compound of interest in various chemical and industrial applications.

Formula: C₆H₆ClNO

InChI: InChI=1S/C6H6ClNO/c1-4-6(7)5(9)2-3-8-4/h2-3H,1H3,(H,8,9)

InChI key: InChIKey=KCNAOZGLCCBDMQ-UHFFFAOYSA-N

SMILES: ClC=1C(O)=CC=NC1C

3-Chloro-2-methylpyridin-4-ol

CAS: 1227499-23-1

Versatile small molecule scaffold

Formula: C₆H₆ClNO

Purity: Min. 95%

Molecular weight: 143.57 g/mol

Ref: 3D-CZB49923