CymitQuimica logo

CAS 1227499-31-1

:

[3,3′-Bipyridine]-2-methanol

Description:
[3,3′-Bipyridine]-2-methanol is an organic compound characterized by the presence of a bipyridine structure, which consists of two pyridine rings connected at the 3-position, along with a hydroxymethyl group (-CH2OH) attached to one of the rings. This compound typically exhibits properties associated with both aromatic and alcohol functionalities, including potential solubility in polar solvents due to the hydroxymethyl group. The bipyridine moiety contributes to its ability to participate in coordination chemistry, making it a candidate for applications in catalysis and as a ligand in metal complexes. The presence of the hydroxymethyl group can also influence its reactivity and interaction with other chemical species. Additionally, [3,3′-Bipyridine]-2-methanol may exhibit interesting electronic properties due to the conjugation of the aromatic rings, which can affect its absorption characteristics in the UV-Vis spectrum. Overall, this compound's unique structure allows for diverse applications in organic synthesis and materials science.
Formula:C11H10N2O
InChI:InChI=1S/C11H10N2O/c14-8-11-10(4-2-6-13-11)9-3-1-5-12-7-9/h1-7,14H,8H2
InChI key:InChIKey=UVNOKJNJLKMQJT-UHFFFAOYSA-N
SMILES:C(O)C1=C(C=CC=N1)C=2C=CC=NC2
Synonyms:
  • [3,3′-Bipyridine]-2-methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.