
CAS 122750-25-8
:6-Chloro-1-methylisatin
Description:
6-Chloro-1-methylisatin is an organic compound characterized by its structure, which includes a chloro substituent and a methyl group attached to an isatin core. Isatin derivatives are known for their diverse biological activities, and the presence of the chlorine atom at the 6-position can influence the compound's reactivity and pharmacological properties. Typically, this compound appears as a solid at room temperature and may exhibit solubility in organic solvents, depending on the specific conditions. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. The compound may also participate in various chemical reactions, such as nucleophilic substitutions or cyclization, due to the presence of electrophilic sites. Additionally, 6-Chloro-1-methylisatin can serve as a precursor for synthesizing other complex molecules, contributing to its utility in research and development within the fields of pharmaceuticals and organic synthesis. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.
Formula:C9H6ClNO2
InChI:InChI=1S/C9H6ClNO2/c1-11-7-4-5(10)2-3-6(7)8(12)9(11)13/h2-4H,1H3
InChI key:InChIKey=WTAJYWAYWPRDDF-UHFFFAOYSA-N
SMILES:CN1C=2C(C(=O)C1=O)=CC=C(Cl)C2
Synonyms:- 6-Chloro-1-methyl-1H-indole-2,3-dione
- Isatin, 6-chloro-1-methyl-
- 6-Chloro-1-methylisatin
- 1H-Indole-2,3-dione, 6-chloro-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.