
CAS 1227502-18-2
:3-(Chloromethyl)-6-fluoro-2-(trifluoromethyl)pyridine
Description:
3-(Chloromethyl)-6-fluoro-2-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloromethyl group at the 3-position and a trifluoromethyl group at the 2-position, along with a fluorine atom at the 6-position, contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It exhibits moderate to high polarity due to the electronegative halogen substituents, which can influence its reactivity and solubility in various solvents. The trifluoromethyl group is known to enhance lipophilicity and can affect biological activity, making this compound of interest in medicinal chemistry and agrochemical applications. Additionally, the presence of multiple halogens may impart specific reactivity patterns, such as susceptibility to nucleophilic substitution or electrophilic aromatic substitution reactions. Overall, this compound's unique structure and substituents make it a valuable candidate for further research and application in various chemical fields.
Formula:C7H4ClF4N
InChI:InChI=1S/C7H4ClF4N/c8-3-4-1-2-5(9)13-6(4)7(10,11)12/h1-2H,3H2
InChI key:InChIKey=QYVNSGIJGGEHMA-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(CCl)C=CC(F)=N1
Synonyms:- 3-(Chloromethyl)-6-fluoro-2-(trifluoromethyl)pyridine
- Pyridine, 3-(chloromethyl)-6-fluoro-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.